C25H23NO7 — CID 143738486
[(1S,5R,13S,17R)-17-hydroxy-14-methylidene-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] (4-nitrophenyl) carbonate (PubChem CID 143738486) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is [(1S,5R,13S,17R)-17-hydroxy-14-methylidene-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(1S,5R,13S,17R)-17-hydroxy-14-methylidene-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 143738486 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [(1S,5R,13S,17R)-17-hydroxy-14-methylidene-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] (4-nitrophenyl) carbonate |
| SMILES | C=C1CC[C@@]2(O)[C@@H]3CCC[C@@]24c2c(ccc(OC(=O)Oc5ccc([N+](=O)[O-])cc5)c2O[C@@H]14)C3 |
| InChI | InChI=1S/C25H23NO7/c1-14-10-12-25(28)16-3-2-11-24(25)20-15(13-16)4-9-19(21(20)33-22(14)24)32-23(27)31-18-7-5-17(6-8-18)26(29)30/h4-9,16,22,28H,1-3,10-13H2/t16-,22+,24+,25-/m1/s1 |
| InChIKey | AVESVNMMXGNSRC-NVVWMRTBSA-N |
| XLogP | 4.61 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|