C17H25N3 — CID 143738606
5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-ethenyl-N-methylaniline (PubChem CID 143738606) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-ethenyl-N-methylaniline.
| Compound Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-ethenyl-N-methylaniline |
|---|---|
| PubChem CID | 143738606 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-ethenyl-N-methylaniline |
| SMILES | C=Cc1ccc(N2CCN3CCCCC3C2)cc1NC |
| InChI | InChI=1S/C17H25N3/c1-3-14-7-8-15(12-17(14)18-2)20-11-10-19-9-5-4-6-16(19)13-20/h3,7-8,12,16,18H,1,4-6,9-11,13H2,2H3 |
| InChIKey | NSBMAILDIZAOHE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|