About 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane
1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane (PubChem CID 143738725) has the molecular formula C22H37NO
and a molecular weight of 331.54 g/mol. Its IUPAC name is 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane.
Molecular Properties
| Compound Name | 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane |
| PubChem CID | 143738725 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane |
| SMILES | C=C(C)OC(C)(C)C.CCc1cc(C2(N)CC2)ccc1CC(C)C |
| InChI | InChI=1S/C15H23N.C7H14O/c1-4-12-10-14(15(16)7-8-15)6-5-13(12)9-11(2)3;1-6(2)8-7(3,4)5/h5-6,10-11H,4,7-9,16H2,1-3H3;1H2,2-5H3 |
| InChIKey | KNLPSNMSKJROSW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane?
The IUPAC name of 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane (CID 143738725) is 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane.
What is the SMILES notation for 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane?
The canonical SMILES for 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane is C=C(C)OC(C)(C)C.CCc1cc(C2(N)CC2)ccc1CC(C)C.
What is the InChIKey of 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane?
The InChIKey is KNLPSNMSKJROSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N.C7H14O/c1-4-12-10-14(15(16)7-8-15)6-5-13(12)9-11(2)3;1-6(2)8-7(3,4)5/h5-6,10-11H,4,7-9,16H2,1-3H3;1H2,2-5H3.
What are the key properties of 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane?
1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane has a molecular weight of 331.54 g/mol, XLogP of 5.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane is sourced from PubChem (CID 143738725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).