C22H37NO — CID 143738725
1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane (PubChem CID 143738725) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane.
| Compound Name | 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane |
|---|---|
| PubChem CID | 143738725 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 1-[3-ethyl-4-(2-methylpropyl)phenyl]cyclopropan-1-amine;2-methyl-2-prop-1-en-2-yloxypropane |
| SMILES | C=C(C)OC(C)(C)C.CCc1cc(C2(N)CC2)ccc1CC(C)C |
| InChI | InChI=1S/C15H23N.C7H14O/c1-4-12-10-14(15(16)7-8-15)6-5-13(12)9-11(2)3;1-6(2)8-7(3,4)5/h5-6,10-11H,4,7-9,16H2,1-3H3;1H2,2-5H3 |
| InChIKey | KNLPSNMSKJROSW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|