About (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione
(4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione (PubChem CID 143739108) has the molecular formula C33H36O4S
and a molecular weight of 528.71 g/mol. Its IUPAC name is (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione.
Molecular Properties
| Compound Name | (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione |
| PubChem CID | 143739108 |
| Molecular Formula | C33H36O4S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione |
| SMILES | CCCCC1CCC(OC(C)=O)CC1.Cc1ccc(Sc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C21H14O2S.C12H22O2/c1-13-9-11-14(12-10-13)24-18-8-4-7-17-19(18)21(23)16-6-3-2-5-15(16)20(17)22;1-3-4-5-11-6-8-12(9-7-11)14-10(2)13/h2-12H,1H3;11-12H,3-9H2,1-2H3 |
| InChIKey | NCQMRMPRRNWPIC-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione?
The IUPAC name of (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione (CID 143739108) is (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione.
What is the SMILES notation for (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione?
The canonical SMILES for (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione is CCCCC1CCC(OC(C)=O)CC1.Cc1ccc(Sc2cccc3c2C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione?
The InChIKey is NCQMRMPRRNWPIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O2S.C12H22O2/c1-13-9-11-14(12-10-13)24-18-8-4-7-17-19(18)21(23)16-6-3-2-5-15(16)20(17)22;1-3-4-5-11-6-8-12(9-7-11)14-10(2)13/h2-12H,1H3;11-12H,3-9H2,1-2H3.
What are the key properties of (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione?
(4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione has a molecular weight of 528.71 g/mol, XLogP of 8.22, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butylcyclohexyl) acetate;1-(4-methylphenyl)sulfanylanthracene-9,10-dione is sourced from PubChem (CID 143739108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).