C26H31NO8 — CID 143739374
2-[(4-ethylphenyl)methyl]-5-[(3R)-oxolan-3-yl]oxy-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (PubChem CID 143739374) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-5-[(3R)-oxolan-3-yl]oxy-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-ethylphenyl)methyl]-5-[(3R)-oxolan-3-yl]oxy-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 143739374 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-5-[(3R)-oxolan-3-yl]oxy-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| SMILES | CCc1ccc(Cc2cc([C@@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O[C@@H]3CCOC3)cc2C#N)cc1 |
| InChI | InChI=1S/C26H31NO8/c1-2-15-3-5-16(6-4-15)9-17-10-20(21(11-18(17)12-27)34-19-7-8-33-14-19)26(32)25(31)24(30)23(29)22(13-28)35-26/h3-6,10-11,19,22-25,28-32H,2,7-9,13-14H2,1H3/t19-,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | DDOKIBDJMGIOBN-GPACXEQDSA-N |
| XLogP | 0.50 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |