C22H22F3NO9S2 — CID 143739383
[4-[[2-cyano-4-methylsulfanyl-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 143739383) has the molecular formula C22H22F3NO9S2 and a molecular weight of 565.54 g/mol. Its IUPAC name is [4-[[2-cyano-4-methylsulfanyl-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[2-cyano-4-methylsulfanyl-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143739383 |
| Molecular Formula | C22H22F3NO9S2 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | [4-[[2-cyano-4-methylsulfanyl-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | CSc1cc(C#N)c(Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22F3NO9S2/c1-36-17-8-13(9-26)12(6-11-2-4-14(5-3-11)35-37(32,33)22(23,24)25)7-15(17)21(31)20(30)19(29)18(28)16(10-27)34-21/h2-5,7-8,16,18-20,27-31H,6,10H2,1H3/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | JLHYENMXDUJYTM-QNDFHXLGSA-N |
| XLogP | 0.72 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|