About 3,6-dimethylthieno[2,3-b]pyridin-2-amine
3,6-dimethylthieno[2,3-b]pyridin-2-amine (PubChem CID 143739772) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 3,6-dimethylthieno[2,3-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3,6-dimethylthieno[2,3-b]pyridin-2-amine |
| PubChem CID | 143739772 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3,6-dimethylthieno[2,3-b]pyridin-2-amine |
| SMILES | Cc1ccc2c(C)c(N)sc2n1 |
| InChI | InChI=1S/C9H10N2S/c1-5-3-4-7-6(2)8(10)12-9(7)11-5/h3-4H,10H2,1-2H3 |
| InChIKey | SIDCXGFTZMDXRF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethylthieno[2,3-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylthieno[2,3-b]pyridin-2-amine?
The IUPAC name of 3,6-dimethylthieno[2,3-b]pyridin-2-amine (CID 143739772) is 3,6-dimethylthieno[2,3-b]pyridin-2-amine.
What is the SMILES notation for 3,6-dimethylthieno[2,3-b]pyridin-2-amine?
The canonical SMILES for 3,6-dimethylthieno[2,3-b]pyridin-2-amine is Cc1ccc2c(C)c(N)sc2n1.
What is the InChIKey of 3,6-dimethylthieno[2,3-b]pyridin-2-amine?
The InChIKey is SIDCXGFTZMDXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-5-3-4-7-6(2)8(10)12-9(7)11-5/h3-4H,10H2,1-2H3.
What are the key properties of 3,6-dimethylthieno[2,3-b]pyridin-2-amine?
3,6-dimethylthieno[2,3-b]pyridin-2-amine has a molecular weight of 178.26 g/mol, XLogP of 2.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylthieno[2,3-b]pyridin-2-amine is sourced from PubChem (CID 143739772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).