C14H23BrN2OS — CID 143740250
2-(5-bromothiophen-2-yl)-N,N-diethyl-3-(propylamino)propanamide (PubChem CID 143740250) has the molecular formula C14H23BrN2OS and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N,N-diethyl-3-(propylamino)propanamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N,N-diethyl-3-(propylamino)propanamide |
|---|---|
| PubChem CID | 143740250 |
| Molecular Formula | C14H23BrN2OS |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N,N-diethyl-3-(propylamino)propanamide |
| SMILES | CCCNCC(C(=O)N(CC)CC)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H23BrN2OS/c1-4-9-16-10-11(12-7-8-13(15)19-12)14(18)17(5-2)6-3/h7-8,11,16H,4-6,9-10H2,1-3H3 |
| InChIKey | FJGPXODBBIESHW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|