C19H24 — CID 143740427
1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(E)-pent-2-en-2-yl]benzene (PubChem CID 143740427) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(E)-pent-2-en-2-yl]benzene.
| Compound Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(E)-pent-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 143740427 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(E)-pent-2-en-2-yl]benzene |
| SMILES | C=C(C)/C=C\C(=C/C)c1ccc(/C(C)=C/CC)cc1 |
| InChI | InChI=1S/C19H24/c1-6-8-16(5)18-11-13-19(14-12-18)17(7-2)10-9-15(3)4/h7-14H,3,6H2,1-2,4-5H3/b10-9-,16-8+,17-7+ |
| InChIKey | WPELVVPNLZYDAX-RYFKLEACSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|