About fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one
fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 143740800) has the molecular formula C7H7F4NO
and a molecular weight of 197.13 g/mol. Its IUPAC name is fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one |
| PubChem CID | 143740800 |
| Molecular Formula | C7H7F4NO |
| Molecular Weight | 197.13 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | CF.O=c1cccc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H4F3NO.CH3F/c7-6(8,9)4-2-1-3-5(11)10-4;1-2/h1-3H,(H,10,11);1H3 |
| InChIKey | WHSAMUUTSXJSFW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one?
The IUPAC name of fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one (CID 143740800) is fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one.
What is the SMILES notation for fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one?
The canonical SMILES for fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one is CF.O=c1cccc(C(F)(F)F)[nH]1.
What is the InChIKey of fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one?
The InChIKey is WHSAMUUTSXJSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.CH3F/c7-6(8,9)4-2-1-3-5(11)10-4;1-2/h1-3H,(H,10,11);1H3.
What are the key properties of fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one?
fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one has a molecular weight of 197.13 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;6-(trifluoromethyl)-1H-pyridin-2-one is sourced from PubChem (CID 143740800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).