About (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol
(2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol (PubChem CID 143740867) has the molecular formula C11H15F3O
and a molecular weight of 220.23 g/mol. Its IUPAC name is (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol.
Molecular Properties
| Compound Name | (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol |
| PubChem CID | 143740867 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol |
| SMILES | C=C(CCC)/C(O)=C\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O/c1-4-6-8(3)10(15)7-9(5-2)11(12,13)14/h5,7,15H,3-4,6H2,1-2H3/b9-5+,10-7+ |
| InChIKey | SXUNVGWQSWONAT-FWMCCXIMSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol?
The IUPAC name of (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol (CID 143740867) is (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol.
What is the SMILES notation for (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol?
The canonical SMILES for (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol is C=C(CCC)/C(O)=C\C(=C/C)C(F)(F)F.
What is the InChIKey of (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol?
The InChIKey is SXUNVGWQSWONAT-FWMCCXIMSA-N. The full InChI is InChI=1S/C11H15F3O/c1-4-6-8(3)10(15)7-9(5-2)11(12,13)14/h5,7,15H,3-4,6H2,1-2H3/b9-5+,10-7+.
What are the key properties of (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol?
(2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol has a molecular weight of 220.23 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-6-methylidene-3-(trifluoromethyl)nona-2,4-dien-5-ol is sourced from PubChem (CID 143740867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).