C22H30Cl2N2O5 — CID 143741044
5,8-dichloro-2-[5-(5-methoxy-2-pyridinyl)pent-1-en-2-yl]-3,4-dihydro-1H-isoquinoline-6,7-diol;methanol (PubChem CID 143741044) has the molecular formula C22H30Cl2N2O5 and a molecular weight of 473.40 g/mol. Its IUPAC name is 5,8-dichloro-2-[5-(5-methoxy-2-pyridinyl)pent-1-en-2-yl]-3,4-dihydro-1H-isoquinoline-6,7-diol;methanol.
| Compound Name | 5,8-dichloro-2-[5-(5-methoxy-2-pyridinyl)pent-1-en-2-yl]-3,4-dihydro-1H-isoquinoline-6,7-diol;methanol |
|---|---|
| PubChem CID | 143741044 |
| Molecular Formula | C22H30Cl2N2O5 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 5,8-dichloro-2-[5-(5-methoxy-2-pyridinyl)pent-1-en-2-yl]-3,4-dihydro-1H-isoquinoline-6,7-diol;methanol |
| SMILES | C=C(CCCc1ccc(OC)cn1)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1.CO.CO |
| InChI | InChI=1S/C20H22Cl2N2O3.2CH4O/c1-12(4-3-5-13-6-7-14(27-2)10-23-13)24-9-8-15-16(11-24)18(22)20(26)19(25)17(15)21;2*1-2/h6-7,10,25-26H,1,3-5,8-9,11H2,2H3;2*2H,1H3 |
| InChIKey | QJHNKFXKMWFGQS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|