About N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide
N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide (PubChem CID 143741270) has the molecular formula C20H22N2O3S2
and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide.
Molecular Properties
| Compound Name | N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide |
| PubChem CID | 143741270 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide |
| SMILES | COc1cc2cc(-c3cccc(N(SC)S(C)=O)c3)nc(C)c2cc1OC |
| InChI | InChI=1S/C20H22N2O3S2/c1-13-17-12-20(25-3)19(24-2)11-15(17)10-18(21-13)14-7-6-8-16(9-14)22(26-4)27(5)23/h6-12H,1-5H3 |
| InChIKey | SWHRDTPRUFYSPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide?
The IUPAC name of N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide (CID 143741270) is N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide.
What is the SMILES notation for N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide?
The canonical SMILES for N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide is COc1cc2cc(-c3cccc(N(SC)S(C)=O)c3)nc(C)c2cc1OC.
What is the InChIKey of N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide?
The InChIKey is SWHRDTPRUFYSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3S2/c1-13-17-12-20(25-3)19(24-2)11-15(17)10-18(21-13)14-7-6-8-16(9-14)22(26-4)27(5)23/h6-12H,1-5H3.
What are the key properties of N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide?
N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide has a molecular weight of 402.54 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(6,7-dimethoxy-1-methylisoquinolin-3-yl)phenyl]-N-methylsulfanylmethanesulfinamide is sourced from PubChem (CID 143741270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).