About (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol
(5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol (PubChem CID 143741357) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol |
| PubChem CID | 143741357 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol |
| SMILES | C/C=c1/cccc(O)/c1=C(/C)N |
| InChI | InChI=1S/C10H13NO/c1-3-8-5-4-6-9(12)10(8)7(2)11/h3-6,12H,11H2,1-2H3/b8-3-,10-7- |
| InChIKey | ACOMMXYDHXHMMQ-CYBIAPKUSA-N |
| XLogP | 0.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol?
The IUPAC name of (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol (CID 143741357) is (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol.
What is the SMILES notation for (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol?
The canonical SMILES for (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol is C/C=c1/cccc(O)/c1=C(/C)N.
What is the InChIKey of (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol?
The InChIKey is ACOMMXYDHXHMMQ-CYBIAPKUSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-8-5-4-6-9(12)10(8)7(2)11/h3-6,12H,11H2,1-2H3/b8-3-,10-7-.
What are the key properties of (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol?
(5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol has a molecular weight of 163.22 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6Z)-6-(1-aminoethylidene)-5-ethylidenecyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 143741357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).