C32H32FN4O4S+ — CID 143741439
CID 143741439 (PubChem CID 143741439) has the molecular formula C32H32FN4O4S+ and a molecular weight of 587.70 g/mol.
| Compound Name | CID 143741439 |
|---|---|
| PubChem CID | 143741439 |
| Molecular Formula | C32H32FN4O4S+ |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | — |
| SMILES | Cc1cc(F)ccc1[SH+](=O)C1(c2cc(N3CCOC[C@@H]3C)nc(-c3ccc(NC(=O)Oc4ccccc4)cc3)n2)CC1 |
| InChI | InChI=1S/C32H31FN4O4S/c1-21-18-24(33)10-13-27(21)42(39)32(14-15-32)28-19-29(37-16-17-40-20-22(37)2)36-30(35-28)23-8-11-25(12-9-23)34-31(38)41-26-6-4-3-5-7-26/h3-13,18-19,22H,14-17,20H2,1-2H3,(H,34,38)/p+1/t22-,42?/m0/s1 |
| InChIKey | RMWSPSDZVOHCTD-RJEKAADTSA-O |
| XLogP | 6.17 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|