C17H19BO2 — CID 143742416
[(2E,4Z,6Z,8Z,10Z)-10-(6-methylidenecyclohexa-2,4-dien-1-ylidene)deca-2,4,6,8-tetraen-4-yl]boronic acid (PubChem CID 143742416) has the molecular formula C17H19BO2 and a molecular weight of 266.15 g/mol. Its IUPAC name is [(2E,4Z,6Z,8Z,10Z)-10-(6-methylidenecyclohexa-2,4-dien-1-ylidene)deca-2,4,6,8-tetraen-4-yl]boronic acid.
| Compound Name | [(2E,4Z,6Z,8Z,10Z)-10-(6-methylidenecyclohexa-2,4-dien-1-ylidene)deca-2,4,6,8-tetraen-4-yl]boronic acid |
|---|---|
| PubChem CID | 143742416 |
| Molecular Formula | C17H19BO2 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(2E,4Z,6Z,8Z,10Z)-10-(6-methylidenecyclohexa-2,4-dien-1-ylidene)deca-2,4,6,8-tetraen-4-yl]boronic acid |
| SMILES | C=c1cccc/c1=C/C=C\C=C/C=C(\C=C\C)B(O)O |
| InChI | InChI=1S/C17H19BO2/c1-3-10-17(18(19)20)14-7-5-4-6-12-16-13-9-8-11-15(16)2/h3-14,19-20H,2H2,1H3/b6-4-,7-5-,10-3+,16-12-,17-14+ |
| InChIKey | WDNGANULQNBMQP-LKWHLTIISA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|