C17H23F2NO — CID 143742864
(1Z,3E)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6-trimethylhepta-1,3-dien-1-amine (PubChem CID 143742864) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is (1Z,3E)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6-trimethylhepta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6-trimethylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143742864 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (1Z,3E)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6-trimethylhepta-1,3-dien-1-amine |
| SMILES | CN/C(=C\C(=C/C(C)C(C)C)OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2NO/c1-11(2)12(3)8-14(21-5)10-17(20-4)15-7-6-13(18)9-16(15)19/h6-12,20H,1-5H3/b14-8+,17-10- |
| InChIKey | YUNXUMWCAXJYPV-MZVQJXNWSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|