C19H27F2NO — CID 143743051
(1Z,3E,6S)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6,7-tetramethylocta-1,3-dien-1-amine (PubChem CID 143743051) has the molecular formula C19H27F2NO and a molecular weight of 323.43 g/mol. Its IUPAC name is (1Z,3E,6S)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6,7-tetramethylocta-1,3-dien-1-amine.
| Compound Name | (1Z,3E,6S)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6,7-tetramethylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143743051 |
| Molecular Formula | C19H27F2NO |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (1Z,3E,6S)-1-(2,4-difluorophenyl)-3-methoxy-N,5,6,7-tetramethylocta-1,3-dien-1-amine |
| SMILES | CN/C(=C\C(=C/C(C)[C@@H](C)C(C)C)OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H27F2NO/c1-12(2)14(4)13(3)9-16(23-6)11-19(22-5)17-8-7-15(20)10-18(17)21/h7-14,22H,1-6H3/b16-9+,19-11-/t13?,14-/m0/s1 |
| InChIKey | IKGVXOTUIOGWCD-INPUTOLLSA-N |
| XLogP | 4.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|