C30H26 — CID 143743055
3-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]phenanthrene (PubChem CID 143743055) has the molecular formula C30H26 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]phenanthrene.
| Compound Name | 3-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]phenanthrene |
|---|---|
| PubChem CID | 143743055 |
| Molecular Formula | C30H26 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[(E)-2-cyclohexa-1,5-dien-1-ylethenyl]-6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]phenanthrene |
| SMILES | C=C/C=C(C=C)/C=C/c1ccc2ccc3ccc(/C=C/C4=CCCC=C4)cc3c2c1 |
| InChI | InChI=1S/C30H26/c1-3-8-23(4-2)11-13-25-15-17-27-19-20-28-18-16-26(22-30(28)29(27)21-25)14-12-24-9-6-5-7-10-24/h3-4,6,8-22H,1-2,5,7H2/b13-11+,14-12+,23-8+ |
| InChIKey | ZHYCHZGWZKULAJ-OLFALBSNSA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|