C42H34N2 — CID 143743326
N-[(Z)-2-[4-[1,2-bis(ethenyl)-3-naphthalen-2-ylphenanthren-9-yl]phenyl]-2-(methylideneamino)ethenyl]-N-ethenylprop-2-en-1-amine (PubChem CID 143743326) has the molecular formula C42H34N2 and a molecular weight of 566.75 g/mol. Its IUPAC name is N-[(Z)-2-[4-[1,2-bis(ethenyl)-3-naphthalen-2-ylphenanthren-9-yl]phenyl]-2-(methylideneamino)ethenyl]-N-ethenylprop-2-en-1-amine.
| Compound Name | N-[(Z)-2-[4-[1,2-bis(ethenyl)-3-naphthalen-2-ylphenanthren-9-yl]phenyl]-2-(methylideneamino)ethenyl]-N-ethenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 143743326 |
| Molecular Formula | C42H34N2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | N-[(Z)-2-[4-[1,2-bis(ethenyl)-3-naphthalen-2-ylphenanthren-9-yl]phenyl]-2-(methylideneamino)ethenyl]-N-ethenylprop-2-en-1-amine |
| SMILES | C=CCN(C=C)/C=C(\N=C)c1ccc(-c2cc3c(C=C)c(C=C)c(-c4ccc5ccccc5c4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C42H34N2/c1-6-24-44(9-4)28-42(43-5)31-21-19-30(20-22-31)38-26-40-35(8-3)34(7-2)39(27-41(40)37-17-13-12-16-36(37)38)33-23-18-29-14-10-11-15-32(29)25-33/h6-23,25-28H,1-5,24H2/b42-28- |
| InChIKey | BAVJVNOBHMFZJL-RKMIRMFUSA-N |
| XLogP | 11.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|