C14H15Cl2NO2 — CID 143743861
methyl 3-amino-4-[(2Z,4E)-4,6-dichlorohexa-2,4-dien-3-yl]benzoate (PubChem CID 143743861) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is methyl 3-amino-4-[(2Z,4E)-4,6-dichlorohexa-2,4-dien-3-yl]benzoate.
| Compound Name | methyl 3-amino-4-[(2Z,4E)-4,6-dichlorohexa-2,4-dien-3-yl]benzoate |
|---|---|
| PubChem CID | 143743861 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 3-amino-4-[(2Z,4E)-4,6-dichlorohexa-2,4-dien-3-yl]benzoate |
| SMILES | C/C=C(C(\Cl)=C/CCl)/c1ccc(C(=O)OC)cc1N |
| InChI | InChI=1S/C14H15Cl2NO2/c1-3-10(12(16)6-7-15)11-5-4-9(8-13(11)17)14(18)19-2/h3-6,8H,7,17H2,1-2H3/b10-3-,12-6+ |
| InChIKey | OHKMXOCJCKWJGD-AQLOUXERSA-N |
| XLogP | 3.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|