C26H34F2O7S3 — CID 143744205
(10aS)-10a-(4-ethylsulfonylphenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;2-ethylsulfonylpropane (PubChem CID 143744205) has the molecular formula C26H34F2O7S3 and a molecular weight of 592.75 g/mol. Its IUPAC name is (10aS)-10a-(4-ethylsulfonylphenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;2-ethylsulfonylpropane.
| Compound Name | (10aS)-10a-(4-ethylsulfonylphenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;2-ethylsulfonylpropane |
|---|---|
| PubChem CID | 143744205 |
| Molecular Formula | C26H34F2O7S3 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | (10aS)-10a-(4-ethylsulfonylphenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;2-ethylsulfonylpropane |
| SMILES | CCS(=O)(=O)C(C)C.CCS(=O)(=O)c1ccc(S(=O)(=O)[C@@]23CCCCC2COc2c(F)ccc(F)c23)cc1 |
| InChI | InChI=1S/C21H22F2O5S2.C5H12O2S/c1-2-29(24,25)15-6-8-16(9-7-15)30(26,27)21-12-4-3-5-14(21)13-28-20-18(23)11-10-17(22)19(20)21;1-4-8(6,7)5(2)3/h6-11,14H,2-5,12-13H2,1H3;5H,4H2,1-3H3/t14?,21-;/m0./s1 |
| InChIKey | PAELYBNMIWTUGG-SDOLJLFYSA-N |
| XLogP | 4.84 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |