C17H21F3N2O3S — CID 143744518
ethyl 2-[[[3-amino-4-methoxy-2-[(Z)-4,4,4-trifluorobut-1-enyl]phenyl]-methylsulfanylmethylidene]amino]acetate (PubChem CID 143744518) has the molecular formula C17H21F3N2O3S and a molecular weight of 390.43 g/mol. Its IUPAC name is ethyl 2-[[[3-amino-4-methoxy-2-[(Z)-4,4,4-trifluorobut-1-enyl]phenyl]-methylsulfanylmethylidene]amino]acetate.
| Compound Name | ethyl 2-[[[3-amino-4-methoxy-2-[(Z)-4,4,4-trifluorobut-1-enyl]phenyl]-methylsulfanylmethylidene]amino]acetate |
|---|---|
| PubChem CID | 143744518 |
| Molecular Formula | C17H21F3N2O3S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 2-[[[3-amino-4-methoxy-2-[(Z)-4,4,4-trifluorobut-1-enyl]phenyl]-methylsulfanylmethylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C(\SC)c1ccc(OC)c(N)c1/C=C\CC(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O3S/c1-4-25-14(23)10-22-16(26-3)12-7-8-13(24-2)15(21)11(12)6-5-9-17(18,19)20/h5-8H,4,9-10,21H2,1-3H3/b6-5-,22-16- |
| InChIKey | IDXNFJYVSSSBRZ-PEGZWWJOSA-N |
| XLogP | 3.92 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|