About 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid
4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid (PubChem CID 14374505) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid |
| PubChem CID | 14374505 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid |
| SMILES | CC1(C)OCC(CCCC(=O)O)O1 |
| InChI | InChI=1S/C9H16O4/c1-9(2)12-6-7(13-9)4-3-5-8(10)11/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | VSMBNPYJOPORJT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid?
The IUPAC name of 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid (CID 14374505) is 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid.
What is the SMILES notation for 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid?
The canonical SMILES for 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid is CC1(C)OCC(CCCC(=O)O)O1.
What is the InChIKey of 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid?
The InChIKey is VSMBNPYJOPORJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-9(2)12-6-7(13-9)4-3-5-8(10)11/h7H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid?
4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethyl-1,3-dioxolan-4-yl)butanoic acid is sourced from PubChem (CID 14374505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).