About 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile
4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile (PubChem CID 14374516) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile |
| PubChem CID | 14374516 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile |
| SMILES | CC1(C)OC[C@H](CCCC#N)O1 |
| InChI | InChI=1S/C9H15NO2/c1-9(2)11-7-8(12-9)5-3-4-6-10/h8H,3-5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | WBUXGNPHKATBOR-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile?
The IUPAC name of 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile (CID 14374516) is 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile.
What is the SMILES notation for 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile?
The canonical SMILES for 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile is CC1(C)OC[C@H](CCCC#N)O1.
What is the InChIKey of 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile?
The InChIKey is WBUXGNPHKATBOR-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15NO2/c1-9(2)11-7-8(12-9)5-3-4-6-10/h8H,3-5,7H2,1-2H3/t8-/m0/s1.
What are the key properties of 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile?
4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile has a molecular weight of 169.22 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butanenitrile is sourced from PubChem (CID 14374516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).