C19H22N4O — CID 143745298
2-amino-N,6-dimethyl-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]quinazoline-4-carboxamide (PubChem CID 143745298) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-amino-N,6-dimethyl-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]quinazoline-4-carboxamide.
| Compound Name | 2-amino-N,6-dimethyl-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 143745298 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-amino-N,6-dimethyl-N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]quinazoline-4-carboxamide |
| SMILES | C=C/C=C(\C=C/C)CN(C)C(=O)c1nc(N)nc2ccc(C)cc12 |
| InChI | InChI=1S/C19H22N4O/c1-5-7-14(8-6-2)12-23(4)18(24)17-15-11-13(3)9-10-16(15)21-19(20)22-17/h5-11H,1,12H2,2-4H3,(H2,20,21,22)/b8-6-,14-7+ |
| InChIKey | MKRAWSVBUUXSDK-VGVFFUEXSA-N |
| XLogP | 3.28 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|