C14H28O5Si — CID 14374539
(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol (PubChem CID 14374539) has the molecular formula C14H28O5Si and a molecular weight of 304.46 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol.
| Compound Name | (3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
|---|---|
| PubChem CID | 14374539 |
| Molecular Formula | C14H28O5Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
| SMILES | CC1(C)O[C@H]2[C@H](COC(O)[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H28O5Si/c1-13(2,3)20(6,7)19-11-10-9(8-16-12(11)15)17-14(4,5)18-10/h9-12,15H,8H2,1-7H3/t9-,10-,11+,12?/m0/s1 |
| InChIKey | GGUHPZSNQRVIAY-WSMDXJOWSA-N |
| XLogP | 2.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|