C26H36N4O3S3 — CID 143745971
N-[2-(2-aminoethyldisulfanyl)ethyl]-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-sulfonamide (PubChem CID 143745971) has the molecular formula C26H36N4O3S3 and a molecular weight of 548.80 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-sulfonamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-sulfonamide |
|---|---|
| PubChem CID | 143745971 |
| Molecular Formula | C26H36N4O3S3 |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-sulfonamide |
| SMILES | CN(C)c1ccc(/C=C/C23OCCN2c2ccc(S(=O)(=O)NCCSSCCN)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C26H36N4O3S3/c1-25(2)23-19-22(36(31,32)28-14-18-35-34-17-13-27)9-10-24(23)30-15-16-33-26(25,30)12-11-20-5-7-21(8-6-20)29(3)4/h5-12,19,28H,13-18,27H2,1-4H3/b12-11+ |
| InChIKey | MLFGLAPYJYISLS-VAWYXSNFSA-N |
| XLogP | 3.91 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|