C17H26F3NO2 — CID 143747626
tert-butyl N-butylcarbamate;1-methyl-4-(trifluoromethyl)benzene (PubChem CID 143747626) has the molecular formula C17H26F3NO2 and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl N-butylcarbamate;1-methyl-4-(trifluoromethyl)benzene.
| Compound Name | tert-butyl N-butylcarbamate;1-methyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143747626 |
| Molecular Formula | C17H26F3NO2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl N-butylcarbamate;1-methyl-4-(trifluoromethyl)benzene |
| SMILES | CCCCNC(=O)OC(C)(C)C.Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H19NO2.C8H7F3/c1-5-6-7-10-8(11)12-9(2,3)4;1-6-2-4-7(5-3-6)8(9,10)11/h5-7H2,1-4H3,(H,10,11);2-5H,1H3 |
| InChIKey | RNFPFFHJVYHPIE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|