About [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane
[2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane (PubChem CID 143747897) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane.
Molecular Properties
| Compound Name | [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane |
| PubChem CID | 143747897 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane |
| SMILES | CC.OCc1coc(-c2ccc(Cn3cnc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C18H15N3O2.C2H6/c22-10-15-11-23-18(20-15)14-7-5-13(6-8-14)9-21-12-19-16-3-1-2-4-17(16)21;1-2/h1-8,11-12,22H,9-10H2;1-2H3 |
| InChIKey | MLSKUTVUVASCOC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane?
The IUPAC name of [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane (CID 143747897) is [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane.
What is the SMILES notation for [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane?
The canonical SMILES for [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane is CC.OCc1coc(-c2ccc(Cn3cnc4ccccc43)cc2)n1.
What is the InChIKey of [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane?
The InChIKey is MLSKUTVUVASCOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2.C2H6/c22-10-15-11-23-18(20-15)14-7-5-13(6-8-14)9-21-12-19-16-3-1-2-4-17(16)21;1-2/h1-8,11-12,22H,9-10H2;1-2H3.
What are the key properties of [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane?
[2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane has a molecular weight of 335.41 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(benzimidazol-1-ylmethyl)phenyl]-1,3-oxazol-4-yl]methanol;ethane is sourced from PubChem (CID 143747897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).