About 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one
2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one (PubChem CID 143747970) has the molecular formula C22H25N3O4S
and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one.
Molecular Properties
| Compound Name | 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
| PubChem CID | 143747970 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-n2ccc(O)cc2=O)cc1.c1cnc(C2CCCCC2)nc1 |
| InChI | InChI=1S/C12H11NO4S.C10H14N2/c1-18(16,17)11-4-2-9(3-5-11)13-7-6-10(14)8-12(13)15;1-2-5-9(6-3-1)10-11-7-4-8-12-10/h2-8,14H,1H3;4,7-9H,1-3,5-6H2 |
| InChIKey | MZXKDMDJMFGGEW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one?
The IUPAC name of 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one (CID 143747970) is 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one.
What is the SMILES notation for 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one?
The canonical SMILES for 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one is CS(=O)(=O)c1ccc(-n2ccc(O)cc2=O)cc1.c1cnc(C2CCCCC2)nc1.
What is the InChIKey of 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one?
The InChIKey is MZXKDMDJMFGGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4S.C10H14N2/c1-18(16,17)11-4-2-9(3-5-11)13-7-6-10(14)8-12(13)15;1-2-5-9(6-3-1)10-11-7-4-8-12-10/h2-8,14H,1H3;4,7-9H,1-3,5-6H2.
What are the key properties of 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one?
2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one has a molecular weight of 427.53 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpyrimidine;4-hydroxy-1-(4-methylsulfonylphenyl)pyridin-2-one is sourced from PubChem (CID 143747970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).