C20H25NO2 — CID 143748205
3-(1-cyclopenta-1,4-dien-1-ylethylamino)-4-methylcyclobut-3-ene-1,2-dione;(3Z,5Z)-4-methylhepta-1,3,5-triene (PubChem CID 143748205) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-(1-cyclopenta-1,4-dien-1-ylethylamino)-4-methylcyclobut-3-ene-1,2-dione;(3Z,5Z)-4-methylhepta-1,3,5-triene.
| Compound Name | 3-(1-cyclopenta-1,4-dien-1-ylethylamino)-4-methylcyclobut-3-ene-1,2-dione;(3Z,5Z)-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143748205 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-(1-cyclopenta-1,4-dien-1-ylethylamino)-4-methylcyclobut-3-ene-1,2-dione;(3Z,5Z)-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C/C.Cc1c(NC(C)C2=CCC=C2)c(=O)c1=O |
| InChI | InChI=1S/C12H13NO2.C8H12/c1-7-10(12(15)11(7)14)13-8(2)9-5-3-4-6-9;1-4-6-8(3)7-5-2/h3,5-6,8,13H,4H2,1-2H3;4-7H,1H2,2-3H3/b;7-5-,8-6- |
| InChIKey | PHPKVNADIGCSEY-UVZMSKQSSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|