C24H18F3NO4S2 — CID 143748315
4-formyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 143748315) has the molecular formula C24H18F3NO4S2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 4-formyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-formyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143748315 |
| Molecular Formula | C24H18F3NO4S2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 4-formyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1c(N(Cc2ccc(OC(F)(F)F)cc2)S(=O)(=O)c2ccc(C=O)cc2)sc2ccccc12 |
| InChI | InChI=1S/C24H18F3NO4S2/c1-16-21-4-2-3-5-22(21)33-23(16)28(34(30,31)20-12-8-18(15-29)9-13-20)14-17-6-10-19(11-7-17)32-24(25,26)27/h2-13,15H,14H2,1H3 |
| InChIKey | NCWHZXLTADWFRU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|