C15H13F3N2O2 — CID 143749406
5-cyclopropyl-3-methyl-1-[3-(trifluoromethoxy)phenyl]pyrazole-4-carbaldehyde (PubChem CID 143749406) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 5-cyclopropyl-3-methyl-1-[3-(trifluoromethoxy)phenyl]pyrazole-4-carbaldehyde.
| Compound Name | 5-cyclopropyl-3-methyl-1-[3-(trifluoromethoxy)phenyl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143749406 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-cyclopropyl-3-methyl-1-[3-(trifluoromethoxy)phenyl]pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(-c2cccc(OC(F)(F)F)c2)c(C2CC2)c1C=O |
| InChI | InChI=1S/C15H13F3N2O2/c1-9-13(8-21)14(10-5-6-10)20(19-9)11-3-2-4-12(7-11)22-15(16,17)18/h2-4,7-8,10H,5-6H2,1H3 |
| InChIKey | ZWPDBJWCKZDBLP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|