About 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol
2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol (PubChem CID 143749682) has the molecular formula C13H19FN2O
and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol.
Molecular Properties
| Compound Name | 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol |
| PubChem CID | 143749682 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol |
| SMILES | CCCC(CO)Cc1[nH]nc2c1CCC=C2F |
| InChI | InChI=1S/C13H19FN2O/c1-2-4-9(8-17)7-12-10-5-3-6-11(14)13(10)16-15-12/h6,9,17H,2-5,7-8H2,1H3,(H,15,16) |
| InChIKey | LQTMDKCJWWEAAY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol?
The IUPAC name of 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol (CID 143749682) is 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol.
What is the SMILES notation for 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol?
The canonical SMILES for 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol is CCCC(CO)Cc1[nH]nc2c1CCC=C2F.
What is the InChIKey of 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol?
The InChIKey is LQTMDKCJWWEAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O/c1-2-4-9(8-17)7-12-10-5-3-6-11(14)13(10)16-15-12/h6,9,17H,2-5,7-8H2,1H3,(H,15,16).
What are the key properties of 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol?
2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol has a molecular weight of 238.31 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-fluoro-4,5-dihydro-2H-indazol-3-yl)methyl]pentan-1-ol is sourced from PubChem (CID 143749682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).