About 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene
6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene (PubChem CID 14375007) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene.
Molecular Properties
| Compound Name | 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene |
| PubChem CID | 14375007 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene |
| SMILES | C#CCOc1c(C(C)(C)C)cc2c(c1OCC#C)OC(C)(C)C=C2 |
| InChI | InChI=1S/C21H24O3/c1-8-12-22-18-16(20(3,4)5)14-15-10-11-21(6,7)24-17(15)19(18)23-13-9-2/h1-2,10-11,14H,12-13H2,3-7H3 |
| InChIKey | YNGZWGUQBHJJJW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene?
The IUPAC name of 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene (CID 14375007) is 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene.
What is the SMILES notation for 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene?
The canonical SMILES for 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene is C#CCOc1c(C(C)(C)C)cc2c(c1OCC#C)OC(C)(C)C=C2.
What is the InChIKey of 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene?
The InChIKey is YNGZWGUQBHJJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O3/c1-8-12-22-18-16(20(3,4)5)14-15-10-11-21(6,7)24-17(15)19(18)23-13-9-2/h1-2,10-11,14H,12-13H2,3-7H3.
What are the key properties of 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene?
6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene has a molecular weight of 324.42 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,2-dimethyl-7,8-bis(prop-2-ynoxy)chromene is sourced from PubChem (CID 14375007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).