About 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole
6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole (PubChem CID 143750107) has the molecular formula C13H16FN
and a molecular weight of 205.28 g/mol. Its IUPAC name is 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole.
Molecular Properties
| Compound Name | 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole |
| PubChem CID | 143750107 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole |
| SMILES | C/C=C/C1=C(C)N(C)C2C=C(F)C=CC12 |
| InChI | InChI=1S/C13H16FN/c1-4-5-11-9(2)15(3)13-8-10(14)6-7-12(11)13/h4-8,12-13H,1-3H3/b5-4+ |
| InChIKey | UZRRARXUGDTQJP-SNAWJCMRSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole?
The IUPAC name of 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole (CID 143750107) is 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole.
What is the SMILES notation for 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole?
The canonical SMILES for 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole is C/C=C/C1=C(C)N(C)C2C=C(F)C=CC12.
What is the InChIKey of 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole?
The InChIKey is UZRRARXUGDTQJP-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H16FN/c1-4-5-11-9(2)15(3)13-8-10(14)6-7-12(11)13/h4-8,12-13H,1-3H3/b5-4+.
What are the key properties of 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole?
6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole has a molecular weight of 205.28 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,2-dimethyl-3-[(E)-prop-1-enyl]-3a,7a-dihydroindole is sourced from PubChem (CID 143750107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).