C12H18FN — CID 143750155
(3E,5Z,8Z)-4-fluoro-1,6,7,9-tetramethyl-2,7-dihydroazonine (PubChem CID 143750155) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (3E,5Z,8Z)-4-fluoro-1,6,7,9-tetramethyl-2,7-dihydroazonine.
| Compound Name | (3E,5Z,8Z)-4-fluoro-1,6,7,9-tetramethyl-2,7-dihydroazonine |
|---|---|
| PubChem CID | 143750155 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (3E,5Z,8Z)-4-fluoro-1,6,7,9-tetramethyl-2,7-dihydroazonine |
| SMILES | C/C1=C/C(F)=C\CN(C)/C(C)=C\C1C |
| InChI | InChI=1S/C12H18FN/c1-9-7-11(3)14(4)6-5-12(13)8-10(9)2/h5,7-9H,6H2,1-4H3/b10-8-,11-7-,12-5+ |
| InChIKey | UZLQWQBCOAYKEW-KCDCQDIPSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |