About 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide
2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide (PubChem CID 143750300) has the molecular formula C11H11ClF3NOS
and a molecular weight of 297.73 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide.
Molecular Properties
| Compound Name | 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide |
| PubChem CID | 143750300 |
| Molecular Formula | C11H11ClF3NOS |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide |
| SMILES | NC(=O)CSC(CC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClF3NOS/c12-8-3-1-7(2-4-8)9(5-11(13,14)15)18-6-10(16)17/h1-4,9H,5-6H2,(H2,16,17) |
| InChIKey | QPQGSYLZVFSZGL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide?
The IUPAC name of 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide (CID 143750300) is 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide.
What is the SMILES notation for 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide?
The canonical SMILES for 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide is NC(=O)CSC(CC(F)(F)F)c1ccc(Cl)cc1.
What is the InChIKey of 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide?
The InChIKey is QPQGSYLZVFSZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3NOS/c12-8-3-1-7(2-4-8)9(5-11(13,14)15)18-6-10(16)17/h1-4,9H,5-6H2,(H2,16,17).
What are the key properties of 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide?
2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide has a molecular weight of 297.73 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-chlorophenyl)-3,3,3-trifluoropropyl]sulfanylacetamide is sourced from PubChem (CID 143750300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).