About 2-ethoxy-4-iodo-1,3-thiazole
2-ethoxy-4-iodo-1,3-thiazole (PubChem CID 143750870) has the molecular formula C5H6INOS
and a molecular weight of 255.08 g/mol. Its IUPAC name is 2-ethoxy-4-iodo-1,3-thiazole.
Molecular Properties
| Compound Name | 2-ethoxy-4-iodo-1,3-thiazole |
| PubChem CID | 143750870 |
| Molecular Formula | C5H6INOS |
| Molecular Weight | 255.08 g/mol |
| Exact Mass | 254.92 |
| IUPAC Name | 2-ethoxy-4-iodo-1,3-thiazole |
| SMILES | CCOc1nc(I)cs1 |
| InChI | InChI=1S/C5H6INOS/c1-2-8-5-7-4(6)3-9-5/h3H,2H2,1H3 |
| InChIKey | IRLRXCYBVIULNL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-4-iodo-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-iodo-1,3-thiazole?
The IUPAC name of 2-ethoxy-4-iodo-1,3-thiazole (CID 143750870) is 2-ethoxy-4-iodo-1,3-thiazole.
What is the SMILES notation for 2-ethoxy-4-iodo-1,3-thiazole?
The canonical SMILES for 2-ethoxy-4-iodo-1,3-thiazole is CCOc1nc(I)cs1.
What is the InChIKey of 2-ethoxy-4-iodo-1,3-thiazole?
The InChIKey is IRLRXCYBVIULNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6INOS/c1-2-8-5-7-4(6)3-9-5/h3H,2H2,1H3.
What are the key properties of 2-ethoxy-4-iodo-1,3-thiazole?
2-ethoxy-4-iodo-1,3-thiazole has a molecular weight of 255.08 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-iodo-1,3-thiazole is sourced from PubChem (CID 143750870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).