About 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine
4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine (PubChem CID 143751446) has the molecular formula C21H35ClN2O
and a molecular weight of 366.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine |
| PubChem CID | 143751446 |
| Molecular Formula | C21H35ClN2O |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine |
| SMILES | C=O.CC1(N)CCCC1.CN1CCC(c2ccc(Cl)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C14H20ClN.C6H13N.CH2O/c1-14(2)10-16(3)9-8-13(14)11-4-6-12(15)7-5-11;1-6(7)4-2-3-5-6;1-2/h4-7,13H,8-10H2,1-3H3;2-5,7H2,1H3;1H2 |
| InChIKey | DVAFTTDRZTZECO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine?
The IUPAC name of 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine (CID 143751446) is 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine.
What is the SMILES notation for 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine?
The canonical SMILES for 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine is C=O.CC1(N)CCCC1.CN1CCC(c2ccc(Cl)cc2)C(C)(C)C1.
What is the InChIKey of 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine?
The InChIKey is DVAFTTDRZTZECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN.C6H13N.CH2O/c1-14(2)10-16(3)9-8-13(14)11-4-6-12(15)7-5-11;1-6(7)4-2-3-5-6;1-2/h4-7,13H,8-10H2,1-3H3;2-5,7H2,1H3;1H2.
What are the key properties of 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine?
4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine has a molecular weight of 366.98 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1,3,3-trimethylpiperidine;formaldehyde;1-methylcyclopentan-1-amine is sourced from PubChem (CID 143751446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).