About 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide
2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide (PubChem CID 143751572) has the molecular formula C12H10N4O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide |
| PubChem CID | 143751572 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide |
| SMILES | N#CC1=CCC=c2nc(CC(N)=O)[nH]c(=O)c2=C1 |
| InChI | InChI=1S/C12H10N4O2/c13-6-7-2-1-3-9-8(4-7)12(18)16-11(15-9)5-10(14)17/h2-4H,1,5H2,(H2,14,17)(H,15,16,18) |
| InChIKey | ZIPAUVPQSWQSOO-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide?
The IUPAC name of 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide (CID 143751572) is 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide.
What is the SMILES notation for 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide?
The canonical SMILES for 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide is N#CC1=CCC=c2nc(CC(N)=O)[nH]c(=O)c2=C1.
What is the InChIKey of 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide?
The InChIKey is ZIPAUVPQSWQSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2/c13-6-7-2-1-3-9-8(4-7)12(18)16-11(15-9)5-10(14)17/h2-4H,1,5H2,(H2,14,17)(H,15,16,18).
What are the key properties of 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide?
2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide has a molecular weight of 242.24 g/mol, XLogP of -1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-cyano-4-oxo-3,8-dihydrocyclohepta[d]pyrimidin-2-yl)acetamide is sourced from PubChem (CID 143751572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).