C34H48NO12P — CID 143752261
tert-butyl N-[2-bis(prop-2-enoxy)phosphoryloxyethyl]-N-[(2E,11Z)-18-hydroperoxy-7,7,14-trimethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate (PubChem CID 143752261) has the molecular formula C34H48NO12P and a molecular weight of 693.73 g/mol. Its IUPAC name is tert-butyl N-[2-bis(prop-2-enoxy)phosphoryloxyethyl]-N-[(2E,11Z)-18-hydroperoxy-7,7,14-trimethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate.
| Compound Name | tert-butyl N-[2-bis(prop-2-enoxy)phosphoryloxyethyl]-N-[(2E,11Z)-18-hydroperoxy-7,7,14-trimethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate |
|---|---|
| PubChem CID | 143752261 |
| Molecular Formula | C34H48NO12P |
| Molecular Weight | 693.73 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | tert-butyl N-[2-bis(prop-2-enoxy)phosphoryloxyethyl]-N-[(2E,11Z)-18-hydroperoxy-7,7,14-trimethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate |
| SMILES | C=CCOP(=O)(OCC=C)OCCN(C(=O)OC(C)(C)C)c1cc2c(c(OO)c1)C(=O)OC(C)C/C=C\CC1OC(C)(C)OC1C/C=C/2 |
| InChI | InChI=1S/C34H48NO12P/c1-9-19-40-48(39,41-20-10-2)42-21-18-35(32(37)46-33(4,5)6)26-22-25-15-13-17-28-27(44-34(7,8)45-28)16-12-11-14-24(3)43-31(36)30(25)29(23-26)47-38/h9-13,15,22-24,27-28,38H,1-2,14,16-21H2,3-8H3/b12-11-,15-13+ |
| InChIKey | CBSVUNUVWOCSHV-XGRKLIJNSA-N |
| XLogP | 7.63 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|