About 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene
2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene (PubChem CID 143753321) has the molecular formula C21H28N2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene.
Molecular Properties
| Compound Name | 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene |
| PubChem CID | 143753321 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene |
| SMILES | C=C(C)c1ccc(N2CCCCC2)nc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C13H18N2.C8H10/c1-11(2)12-6-7-13(14-10-12)15-8-4-3-5-9-15;1-7-4-3-5-8(2)6-7/h6-7,10H,1,3-5,8-9H2,2H3;3-6H,1-2H3 |
| InChIKey | PTNDPZRRQIHSQP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene?
The IUPAC name of 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene (CID 143753321) is 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene.
What is the SMILES notation for 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene?
The canonical SMILES for 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene is C=C(C)c1ccc(N2CCCCC2)nc1.Cc1cccc(C)c1.
What is the InChIKey of 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene?
The InChIKey is PTNDPZRRQIHSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2.C8H10/c1-11(2)12-6-7-13(14-10-12)15-8-4-3-5-9-15;1-7-4-3-5-8(2)6-7/h6-7,10H,1,3-5,8-9H2,2H3;3-6H,1-2H3.
What are the key properties of 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene?
2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene has a molecular weight of 308.47 g/mol, XLogP of 5.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-5-prop-1-en-2-ylpyridine;1,3-xylene is sourced from PubChem (CID 143753321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).