C32H39N5O5S — CID 143753515
7-(benzenesulfonyl)-5-[3-(dimethylamino)prop-1-ynyl]-N-(3-ethyl-4-methoxy-5-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;tert-butyl formate (PubChem CID 143753515) has the molecular formula C32H39N5O5S and a molecular weight of 605.76 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-5-[3-(dimethylamino)prop-1-ynyl]-N-(3-ethyl-4-methoxy-5-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;tert-butyl formate.
| Compound Name | 7-(benzenesulfonyl)-5-[3-(dimethylamino)prop-1-ynyl]-N-(3-ethyl-4-methoxy-5-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;tert-butyl formate |
|---|---|
| PubChem CID | 143753515 |
| Molecular Formula | C32H39N5O5S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 7-(benzenesulfonyl)-5-[3-(dimethylamino)prop-1-ynyl]-N-(3-ethyl-4-methoxy-5-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CCc1cc(Nc2ncnc3c2c(C#CCN(C)C)cn3S(=O)(=O)c2ccccc2)cc(C)c1OC |
| InChI | InChI=1S/C27H29N5O3S.C5H10O2/c1-6-20-16-22(15-19(2)25(20)35-5)30-26-24-21(11-10-14-31(3)4)17-32(27(24)29-18-28-26)36(33,34)23-12-8-7-9-13-23;1-5(2,3)7-4-6/h7-9,12-13,15-18H,6,14H2,1-5H3,(H,28,29,30);4H,1-3H3 |
| InChIKey | AMXCKOKZJVDRPI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|