About tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate
tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate (PubChem CID 143753517) has the molecular formula C15H21FO6
and a molecular weight of 316.32 g/mol. Its IUPAC name is tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate |
| PubChem CID | 143753517 |
| Molecular Formula | C15H21FO6 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate |
| SMILES | CC(F)Oc1ccc(C=O)cc1OCC(=O)OC(C)(C)C.O |
| InChI | InChI=1S/C15H19FO5.H2O/c1-10(16)20-12-6-5-11(8-17)7-13(12)19-9-14(18)21-15(2,3)4;/h5-8,10H,9H2,1-4H3;1H2 |
| InChIKey | MGKOHPFYZKLAMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate?
The IUPAC name of tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate (CID 143753517) is tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate.
What is the SMILES notation for tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate?
The canonical SMILES for tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate is CC(F)Oc1ccc(C=O)cc1OCC(=O)OC(C)(C)C.O.
What is the InChIKey of tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate?
The InChIKey is MGKOHPFYZKLAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO5.H2O/c1-10(16)20-12-6-5-11(8-17)7-13(12)19-9-14(18)21-15(2,3)4;/h5-8,10H,9H2,1-4H3;1H2.
What are the key properties of tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate?
tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate has a molecular weight of 316.32 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-(1-fluoroethoxy)-5-formylphenoxy]acetate;hydrate is sourced from PubChem (CID 143753517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).