About (4-oxocyclohexyl)methoxy thiohypoiodite
(4-oxocyclohexyl)methoxy thiohypoiodite (PubChem CID 143754074) has the molecular formula C7H11IO2S
and a molecular weight of 286.13 g/mol. Its IUPAC name is (4-oxocyclohexyl)methoxy thiohypoiodite.
Molecular Properties
| Compound Name | (4-oxocyclohexyl)methoxy thiohypoiodite |
| PubChem CID | 143754074 |
| Molecular Formula | C7H11IO2S |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | (4-oxocyclohexyl)methoxy thiohypoiodite |
| SMILES | O=C1CCC(COSI)CC1 |
| InChI | InChI=1S/C7H11IO2S/c8-11-10-5-6-1-3-7(9)4-2-6/h6H,1-5H2 |
| InChIKey | QOJOABZQFPIXFL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-oxocyclohexyl)methoxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexyl)methoxy thiohypoiodite?
The IUPAC name of (4-oxocyclohexyl)methoxy thiohypoiodite (CID 143754074) is (4-oxocyclohexyl)methoxy thiohypoiodite.
What is the SMILES notation for (4-oxocyclohexyl)methoxy thiohypoiodite?
The canonical SMILES for (4-oxocyclohexyl)methoxy thiohypoiodite is O=C1CCC(COSI)CC1.
What is the InChIKey of (4-oxocyclohexyl)methoxy thiohypoiodite?
The InChIKey is QOJOABZQFPIXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11IO2S/c8-11-10-5-6-1-3-7(9)4-2-6/h6H,1-5H2.
What are the key properties of (4-oxocyclohexyl)methoxy thiohypoiodite?
(4-oxocyclohexyl)methoxy thiohypoiodite has a molecular weight of 286.13 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexyl)methoxy thiohypoiodite is sourced from PubChem (CID 143754074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).