C9H12O2 — CID 143754731
1-(7-hydroxycyclohepta-1,6-dien-1-yl)ethanone (PubChem CID 143754731) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-(7-hydroxycyclohepta-1,6-dien-1-yl)ethanone.
| Compound Name | 1-(7-hydroxycyclohepta-1,6-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 143754731 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-(7-hydroxycyclohepta-1,6-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CCCCC=C1O |
| InChI | InChI=1S/C9H12O2/c1-7(10)8-5-3-2-4-6-9(8)11/h5-6,11H,2-4H2,1H3 |
| InChIKey | PYWBRFFMUXEBLN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |