About 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene
3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene (PubChem CID 143755544) has the molecular formula C21H24BrF2NO3
and a molecular weight of 456.33 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene.
Molecular Properties
| Compound Name | 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene |
| PubChem CID | 143755544 |
| Molecular Formula | C21H24BrF2NO3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene |
| SMILES | CC(c1ccc(Br)cc1F)N1CCC(CCCO)OC1=O.Fc1ccccc1 |
| InChI | InChI=1S/C15H19BrFNO3.C6H5F/c1-10(13-5-4-11(16)9-14(13)17)18-7-6-12(3-2-8-19)21-15(18)20;7-6-4-2-1-3-5-6/h4-5,9-10,12,19H,2-3,6-8H2,1H3;1-5H |
| InChIKey | OPJHNSOVZQTVFO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene?
The IUPAC name of 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene (CID 143755544) is 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene.
What is the SMILES notation for 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene?
The canonical SMILES for 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene is CC(c1ccc(Br)cc1F)N1CCC(CCCO)OC1=O.Fc1ccccc1.
What is the InChIKey of 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene?
The InChIKey is OPJHNSOVZQTVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrFNO3.C6H5F/c1-10(13-5-4-11(16)9-14(13)17)18-7-6-12(3-2-8-19)21-15(18)20;7-6-4-2-1-3-5-6/h4-5,9-10,12,19H,2-3,6-8H2,1H3;1-5H.
What are the key properties of 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene?
3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene has a molecular weight of 456.33 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-bromo-2-fluorophenyl)ethyl]-6-(3-hydroxypropyl)-1,3-oxazinan-2-one;fluorobenzene is sourced from PubChem (CID 143755544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).