C27H30F2NO5P — CID 143755609
benzene;3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl dihydrogen phosphite (PubChem CID 143755609) has the molecular formula C27H30F2NO5P and a molecular weight of 517.51 g/mol. Its IUPAC name is benzene;3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl dihydrogen phosphite.
| Compound Name | benzene;3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl dihydrogen phosphite |
|---|---|
| PubChem CID | 143755609 |
| Molecular Formula | C27H30F2NO5P |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | benzene;3-[3-[1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl dihydrogen phosphite |
| SMILES | CC(c1ccc(-c2ccc(F)cc2F)cc1)N1CCC(CCCOP(O)O)OC1=O.c1ccccc1 |
| InChI | InChI=1S/C21H24F2NO5P.C6H6/c1-14(24-11-10-18(29-21(24)25)3-2-12-28-30(26)27)15-4-6-16(7-5-15)19-9-8-17(22)13-20(19)23;1-2-4-6-5-3-1/h4-9,13-14,18,26-27H,2-3,10-12H2,1H3;1-6H |
| InChIKey | ZNMICIZISDKYGQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|